Resmethrin is a pyrethroid insecticide with many uses, including control of the adult mosquito population.
Quick Facts Names, Identifiers ...
Resmethrin
|
| Names |
| IUPAC names
(5-benzylfuran-3-yl)methyl (2R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate;
5-benzyl-3-[({[(3R)-2,2-dimethyl-3-(2-methylprop-1-en-1-yl)
cyclopropyl]carbonyl}oxy)methyl]furan;
(5-Benzyl-3-furyl)methyl-2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropancarboxylate;
5-benzyl-3-furylmethyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate;
5-benzyl-3-furylmethyl(1RS)-cis-trans-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate;
5-benzyl-3-furylmethyl(±)-cis-trans-chrysanthemate |
| Other names
[5-(phenylmethyl)-3-furanyl]methyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate |
| Identifiers |
|
|
|
|
| ChEBI |
|
| ChEMBL |
|
| ChemSpider |
|
| ECHA InfoCard |
100.030.842  |
| EC Number |
|
| KEGG |
|
|
|
| RTECS number |
|
| UNII |
|
| UN number |
3082 3349 2902 |
|
|
InChI=1S/C22H26O3/c1-15(2)10-19-20(22(19,3)4)21(23)25-14-17-12-18(24-13-17)11-16-8-6-5-7-9-16/h5-10,12-13,19-20H,11,14H2,1-4H3/t19-,20?/m1/s1  YKey: VEMKTZHHVJILDY-FIWHBWSRSA-N YInChI=1/C22H26O3/c1-15(2)10-19-20(22(19,3)4)21(23)25-14-17-12-18(24-13-17)11-16-8-6-5-7-9-16/h5-10,12-13,19-20H,11,14H2,1-4H3/t19-,20?/m1/s1 Key: VEMKTZHHVJILDY-FIWHBWSRBD
|
O=C(OCc2cc(Cc1ccccc1)oc2)C3[C@@H](/C=C(\C)C)C3(C)C
|
| Properties |
|
C22H26O3 |
| Molar mass |
338.44 g/mol |
| Hazards |
| GHS labelling: |
|
  |
|
Warning |
|
H302, H410 |
|
P264, P270, P273, P301+P312, P330, P391, P501 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Close
The resmethrin molecule has four stereoisomers determined by cis-trans orientation around a carbon triangle and chirality. Technical resmethrin is a mixture of (1R,trans)-, (1R,cis)-, (1S,trans)-, and (1S,cis)- isomers, typically in a ratio of 4:1:4:1. The 1R isomers (both trans and cis) show strong insecticidal activity, while the 1S isomers do not. The (1R,trans)- isomer is also known as bioresmethrin,(+)-trans-resmethrin, or d-trans-resmethrin; although bioresmethrin has been used alone as a pesticide active ingredient, it is not now registered as a separate active ingredient (AI) by the U.S. EPA. The (1R,cis)- isomer is known as cismethrin, but this is also not registered in the U.S. for use alone as a pesticide AI.
Commercial trade names for products that contain resmethrin are: Chrysron, Crossfire, Lethalaire V-26, Pynosect, Raid Flying Insect Killer, Scourge, SPB-1382, Sun-Bugger #4, Synthrin, Syntox, Vectrin, and Whitmire PT-110.[1]
