Maneb
Maneb
Chemical compound
{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 434399765 | ImageFile = Maneb.svg | ImageAlt = | IUPACName = [[2-[(Dithiocarboxy)amino]ethyl]carbamodithioato]](2-)-kS,kS']manganese | OtherNames = Manganese ethylene-1,2-bisdithiocarbamate, polymer |Section1=!Identifiers
|-
|
|
|-
|
|
|-
|
|-
| ECHA InfoCard | 100.032.400 |-
|
|
|-
| UNII
|
|-
|
|
|-
|
- InChI=1S/C4H8N2S4.Mn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2Key: YKSNLCVSTHTHJA-UHFFFAOYSA-L
|-
|
- [Mn+]SC(=S)NCCNC(=S)S[Mn]SC(=S)NCCNC(=S)S[Mn]SC(=S)NCCNC(=S)S[Mn]SC(=S)NCCNC(=S)S[Mn]SC(=S)NCCNC(=S)[S-]
|- |Section2=!Properties
|-
|
| (C4H6MnN2S4)n
|-
| Appearance | Yellow to brown colored crystalline solid |-
| Density | 1.92 g/cm3 |- | Melting point | 192 to 204 °C (378 to 399 °F; 465 to 477 K) (decomposes)
|-
|
| 160 mg/L |- |Section3=!Hazards
|-
| GHS labelling: |-
|-
|
|- }}
Maneb is a fungicide and a polymeric complex of manganese with the ethylene bis(dithiocarbamate) anionic ligand.[1]